C17H26BrN — CID 104574749
2-bromo-N-[(4-tert-butylcyclohexyl)methyl]aniline (PubChem CID 104574749) has the molecular formula C17H26BrN and a molecular weight of 324.31 g/mol. Its IUPAC name is 2-bromo-N-[(4-tert-butylcyclohexyl)methyl]aniline.
| Compound Name | 2-bromo-N-[(4-tert-butylcyclohexyl)methyl]aniline |
|---|---|
| PubChem CID | 104574749 |
| Molecular Formula | C17H26BrN |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-bromo-N-[(4-tert-butylcyclohexyl)methyl]aniline |
| SMILES | CC(C)(C)C1CCC(CNc2ccccc2Br)CC1 |
| InChI | InChI=1S/C17H26BrN/c1-17(2,3)14-10-8-13(9-11-14)12-19-16-7-5-4-6-15(16)18/h4-7,13-14,19H,8-12H2,1-3H3 |
| InChIKey | YCCULQVBWKBSQG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |