C15H20F2N2O2 — CID 115507763
N-[(4-ethylcyclohexyl)methyl]-3,5-difluoro-2-nitroaniline (PubChem CID 115507763) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is N-[(4-ethylcyclohexyl)methyl]-3,5-difluoro-2-nitroaniline.
| Compound Name | N-[(4-ethylcyclohexyl)methyl]-3,5-difluoro-2-nitroaniline |
|---|---|
| PubChem CID | 115507763 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-[(4-ethylcyclohexyl)methyl]-3,5-difluoro-2-nitroaniline |
| SMILES | CCC1CCC(CNc2cc(F)cc(F)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-2-10-3-5-11(6-4-10)9-18-14-8-12(16)7-13(17)15(14)19(20)21/h7-8,10-11,18H,2-6,9H2,1H3 |
| InChIKey | NEICAAUYRQPNMS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|