C12H12F2N2O5 — CID 115507487
5-[(3,5-difluoro-2-nitroanilino)methyl]oxolane-2-carboxylic acid (PubChem CID 115507487) has the molecular formula C12H12F2N2O5 and a molecular weight of 302.23 g/mol. Its IUPAC name is 5-[(3,5-difluoro-2-nitroanilino)methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(3,5-difluoro-2-nitroanilino)methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 115507487 |
| Molecular Formula | C12H12F2N2O5 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 5-[(3,5-difluoro-2-nitroanilino)methyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(CNc2cc(F)cc(F)c2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C12H12F2N2O5/c13-6-3-8(14)11(16(19)20)9(4-6)15-5-7-1-2-10(21-7)12(17)18/h3-4,7,10,15H,1-2,5H2,(H,17,18) |
| InChIKey | GIUFKCJBXSQOMA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|