C11H9F4NO2 — CID 106492449
5-[(2,3-difluoroanilino)methyl]-3,3-difluorooxolan-2-one (PubChem CID 106492449) has the molecular formula C11H9F4NO2 and a molecular weight of 263.19 g/mol. Its IUPAC name is 5-[(2,3-difluoroanilino)methyl]-3,3-difluorooxolan-2-one.
| Compound Name | 5-[(2,3-difluoroanilino)methyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106492449 |
| Molecular Formula | C11H9F4NO2 |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-[(2,3-difluoroanilino)methyl]-3,3-difluorooxolan-2-one |
| SMILES | O=C1OC(CNc2cccc(F)c2F)CC1(F)F |
| InChI | InChI=1S/C11H9F4NO2/c12-7-2-1-3-8(9(7)13)16-5-6-4-11(14,15)10(17)18-6/h1-3,6,16H,4-5H2 |
| InChIKey | AGESCJKLEUJJKD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |