C19H20N2O3 — CID 140546336
1-(ethylamino)-5-(2-methoxyethylamino)anthracene-9,10-dione (PubChem CID 140546336) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-(ethylamino)-5-(2-methoxyethylamino)anthracene-9,10-dione.
| Compound Name | 1-(ethylamino)-5-(2-methoxyethylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 140546336 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(ethylamino)-5-(2-methoxyethylamino)anthracene-9,10-dione |
| SMILES | CCNc1cccc2c1C(=O)c1cccc(NCCOC)c1C2=O |
| InChI | InChI=1S/C19H20N2O3/c1-3-20-14-8-4-6-12-16(14)18(22)13-7-5-9-15(17(13)19(12)23)21-10-11-24-2/h4-9,20-21H,3,10-11H2,1-2H3 |
| InChIKey | ZBPYZMGUSNTIMR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|