C20H24N2O4 — CID 143008891
1-amino-5-(3-hydroxypropylamino)anthracene-9,10-dione;propan-1-ol (PubChem CID 143008891) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-amino-5-(3-hydroxypropylamino)anthracene-9,10-dione;propan-1-ol.
| Compound Name | 1-amino-5-(3-hydroxypropylamino)anthracene-9,10-dione;propan-1-ol |
|---|---|
| PubChem CID | 143008891 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-amino-5-(3-hydroxypropylamino)anthracene-9,10-dione;propan-1-ol |
| SMILES | CCCO.Nc1cccc2c1C(=O)c1cccc(NCCCO)c1C2=O |
| InChI | InChI=1S/C17H16N2O3.C3H8O/c18-12-6-1-4-10-14(12)16(21)11-5-2-7-13(15(11)17(10)22)19-8-3-9-20;1-2-3-4/h1-2,4-7,19-20H,3,8-9,18H2;4H,2-3H2,1H3 |
| InChIKey | WVBSXXSKSKZKOP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|