C9H16N4 — CID 141424845
N',N'-diamino-N-(2-methylphenyl)ethane-1,2-diamine (PubChem CID 141424845) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N',N'-diamino-N-(2-methylphenyl)ethane-1,2-diamine.
| Compound Name | N',N'-diamino-N-(2-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 141424845 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N',N'-diamino-N-(2-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1ccccc1NCCN(N)N |
| InChI | InChI=1S/C9H16N4/c1-8-4-2-3-5-9(8)12-6-7-13(10)11/h2-5,12H,6-7,10-11H2,1H3 |
| InChIKey | KVSMGEXTHPJBRL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|