C11H15IN2 — CID 106182064
2-iodo-1-N-(3-methylbut-2-enyl)benzene-1,4-diamine (PubChem CID 106182064) has the molecular formula C11H15IN2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 2-iodo-1-N-(3-methylbut-2-enyl)benzene-1,4-diamine.
| Compound Name | 2-iodo-1-N-(3-methylbut-2-enyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106182064 |
| Molecular Formula | C11H15IN2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-iodo-1-N-(3-methylbut-2-enyl)benzene-1,4-diamine |
| SMILES | CC(C)=CCNc1ccc(N)cc1I |
| InChI | InChI=1S/C11H15IN2/c1-8(2)5-6-14-11-4-3-9(13)7-10(11)12/h3-5,7,14H,6,13H2,1-2H3 |
| InChIKey | XQPWRCXWUDCVTE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|