C18H32N2O — CID 58596128
1-N-[3-(2-ethylhexoxy)propyl]-2-methylbenzene-1,4-diamine (PubChem CID 58596128) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-N-[3-(2-ethylhexoxy)propyl]-2-methylbenzene-1,4-diamine.
| Compound Name | 1-N-[3-(2-ethylhexoxy)propyl]-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 58596128 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 1-N-[3-(2-ethylhexoxy)propyl]-2-methylbenzene-1,4-diamine |
| SMILES | CCCCC(CC)COCCCNc1ccc(N)cc1C |
| InChI | InChI=1S/C18H32N2O/c1-4-6-8-16(5-2)14-21-12-7-11-20-18-10-9-17(19)13-15(18)3/h9-10,13,16,20H,4-8,11-12,14,19H2,1-3H3 |
| InChIKey | DLVJWNWRCJEJJF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|