C24H32F6N6O2 — CID 159031605
N-[2-(4-aminoanilino)ethyl]-2,2,2-trifluoroacetamide;N-[6-(4-aminoanilino)hexyl]-2,2,2-trifluoroacetamide (PubChem CID 159031605) has the molecular formula C24H32F6N6O2 and a molecular weight of 550.55 g/mol. Its IUPAC name is N-[2-(4-aminoanilino)ethyl]-2,2,2-trifluoroacetamide;N-[6-(4-aminoanilino)hexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(4-aminoanilino)ethyl]-2,2,2-trifluoroacetamide;N-[6-(4-aminoanilino)hexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 159031605 |
| Molecular Formula | C24H32F6N6O2 |
| Molecular Weight | 550.55 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | N-[2-(4-aminoanilino)ethyl]-2,2,2-trifluoroacetamide;N-[6-(4-aminoanilino)hexyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1ccc(NCCCCCCNC(=O)C(F)(F)F)cc1.Nc1ccc(NCCNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H20F3N3O.C10H12F3N3O/c15-14(16,17)13(21)20-10-4-2-1-3-9-19-12-7-5-11(18)6-8-12;11-10(12,13)9(17)16-6-5-15-8-3-1-7(14)2-4-8/h5-8,19H,1-4,9-10,18H2,(H,20,21);1-4,15H,5-6,14H2,(H,16,17) |
| InChIKey | JUYOAHFTMRMSHD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|