C12H17F3N4O — CID 82331534
N-[4-[(5-amino-3-methyl-2-pyridinyl)amino]butyl]-2,2,2-trifluoroacetamide (PubChem CID 82331534) has the molecular formula C12H17F3N4O and a molecular weight of 290.29 g/mol. Its IUPAC name is N-[4-[(5-amino-3-methyl-2-pyridinyl)amino]butyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[(5-amino-3-methyl-2-pyridinyl)amino]butyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 82331534 |
| Molecular Formula | C12H17F3N4O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-[4-[(5-amino-3-methyl-2-pyridinyl)amino]butyl]-2,2,2-trifluoroacetamide |
| SMILES | Cc1cc(N)cnc1NCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N4O/c1-8-6-9(16)7-19-10(8)17-4-2-3-5-18-11(20)12(13,14)15/h6-7H,2-5,16H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | RJZLAVQSBCJWGM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|