C14H20IN3 — CID 46189565
N'-(1-methylquinolin-1-ium-7-yl)butane-1,4-diamine iodide (PubChem CID 46189565) has the molecular formula C14H20IN3 and a molecular weight of 357.24 g/mol. Its IUPAC name is N'-(1-methylquinolin-1-ium-7-yl)butane-1,4-diamine iodide.
| Compound Name | N'-(1-methylquinolin-1-ium-7-yl)butane-1,4-diamine iodide |
|---|---|
| PubChem CID | 46189565 |
| Molecular Formula | C14H20IN3 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | N'-(1-methylquinolin-1-ium-7-yl)butane-1,4-diamine iodide |
| SMILES | C[n+]1cccc2ccc(NCCCCN)cc21.[I-] |
| InChI | InChI=1S/C14H19N3.HI/c1-17-10-4-5-12-6-7-13(11-14(12)17)16-9-3-2-8-15;/h4-7,10-11H,2-3,8-9,15H2,1H3;1H |
| InChIKey | QBXWAQJHXRGZPD-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|