C11H9ClF2N2O3 — CID 112746697
(E)-4-[(2-chloro-4,6-difluorophenyl)carbamoylamino]but-2-enoic acid (PubChem CID 112746697) has the molecular formula C11H9ClF2N2O3 and a molecular weight of 290.65 g/mol. Its IUPAC name is (E)-4-[(2-chloro-4,6-difluorophenyl)carbamoylamino]but-2-enoic acid.
| Compound Name | (E)-4-[(2-chloro-4,6-difluorophenyl)carbamoylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 112746697 |
| Molecular Formula | C11H9ClF2N2O3 |
| Molecular Weight | 290.65 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (E)-4-[(2-chloro-4,6-difluorophenyl)carbamoylamino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/CNC(=O)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C11H9ClF2N2O3/c12-7-4-6(13)5-8(14)10(7)16-11(19)15-3-1-2-9(17)18/h1-2,4-5H,3H2,(H,17,18)(H2,15,16,19)/b2-1+ |
| InChIKey | LBEAEWPAEVSSRE-OWOJBTEDSA-N |
| XLogP | 2.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|