C11H11ClF2N2O2S — CID 107769794
2-acetamido-N-(2-chloro-4,6-difluorophenyl)-3-sulfanylpropanamide (PubChem CID 107769794) has the molecular formula C11H11ClF2N2O2S and a molecular weight of 308.74 g/mol. Its IUPAC name is 2-acetamido-N-(2-chloro-4,6-difluorophenyl)-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-(2-chloro-4,6-difluorophenyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769794 |
| Molecular Formula | C11H11ClF2N2O2S |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2-acetamido-N-(2-chloro-4,6-difluorophenyl)-3-sulfanylpropanamide |
| SMILES | CC(=O)NC(CS)C(=O)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C11H11ClF2N2O2S/c1-5(17)15-9(4-19)11(18)16-10-7(12)2-6(13)3-8(10)14/h2-3,9,19H,4H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | KHFUIRUSKIKMSY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|