C11H11BrF2N2O2S — CID 107769972
2-acetamido-N-(5-bromo-2,4-difluorophenyl)-3-sulfanylpropanamide (PubChem CID 107769972) has the molecular formula C11H11BrF2N2O2S and a molecular weight of 353.19 g/mol. Its IUPAC name is 2-acetamido-N-(5-bromo-2,4-difluorophenyl)-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-(5-bromo-2,4-difluorophenyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769972 |
| Molecular Formula | C11H11BrF2N2O2S |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 2-acetamido-N-(5-bromo-2,4-difluorophenyl)-3-sulfanylpropanamide |
| SMILES | CC(=O)NC(CS)C(=O)Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C11H11BrF2N2O2S/c1-5(17)15-10(4-19)11(18)16-9-2-6(12)7(13)3-8(9)14/h2-3,10,19H,4H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | XBPMEIHRJITJRY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|