C10H9BrF2N2O4 — CID 102854365
2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]-3-hydroxypropanoic acid (PubChem CID 102854365) has the molecular formula C10H9BrF2N2O4 and a molecular weight of 339.09 g/mol. Its IUPAC name is 2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | 2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 102854365 |
| Molecular Formula | C10H9BrF2N2O4 |
| Molecular Weight | 339.09 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]-3-hydroxypropanoic acid |
| SMILES | O=C(Nc1cc(Br)c(F)cc1F)NC(CO)C(=O)O |
| InChI | InChI=1S/C10H9BrF2N2O4/c11-4-1-7(6(13)2-5(4)12)14-10(19)15-8(3-16)9(17)18/h1-2,8,16H,3H2,(H,17,18)(H2,14,15,19) |
| InChIKey | OHGDNSBEAPJYKD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.09 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|