C12H12ClF3N2O2S — CID 107769554
2-acetamido-N-[2-chloro-4-(trifluoromethyl)phenyl]-3-sulfanylpropanamide (PubChem CID 107769554) has the molecular formula C12H12ClF3N2O2S and a molecular weight of 340.75 g/mol. Its IUPAC name is 2-acetamido-N-[2-chloro-4-(trifluoromethyl)phenyl]-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-[2-chloro-4-(trifluoromethyl)phenyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769554 |
| Molecular Formula | C12H12ClF3N2O2S |
| Molecular Weight | 340.75 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-acetamido-N-[2-chloro-4-(trifluoromethyl)phenyl]-3-sulfanylpropanamide |
| SMILES | CC(=O)NC(CS)C(=O)Nc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H12ClF3N2O2S/c1-6(19)17-10(5-21)11(20)18-9-3-2-7(4-8(9)13)12(14,15)16/h2-4,10,21H,5H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | JMHLEIGRHFBVLS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.75 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|