C11H8F5N3O2 — CID 115564785
1-(N'-hydroxycarbamimidoyl)-N-(2,3,4,5,6-pentafluorophenyl)cyclopropane-1-carboxamide (PubChem CID 115564785) has the molecular formula C11H8F5N3O2 and a molecular weight of 309.19 g/mol. Its IUPAC name is 1-(N'-hydroxycarbamimidoyl)-N-(2,3,4,5,6-pentafluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(N'-hydroxycarbamimidoyl)-N-(2,3,4,5,6-pentafluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 115564785 |
| Molecular Formula | C11H8F5N3O2 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 1-(N'-hydroxycarbamimidoyl)-N-(2,3,4,5,6-pentafluorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(=NO)C1(C(=O)Nc2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C11H8F5N3O2/c12-3-4(13)6(15)8(7(16)5(3)14)18-10(20)11(1-2-11)9(17)19-21/h21H,1-2H2,(H2,17,19)(H,18,20) |
| InChIKey | IIRWWPWXPSVOPH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|