3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid

C13H14BrNO5S — CID 104517641

IUPAC3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid
SMILESO=C(O)c1ccc(NC(=O)C2CCCCS2(=O)=O)c(Br)c1
InChIInChI=1S/C13H14BrNO5S/c14-9-7-8(13(17)18)4-5-10(9)15-12(16)11-3-1-2-6-21(11,19)20/h4-5,7,11H,1-3,6H2,(H,15,16)(H,17,18)
InChIKeyDVMZBPYHQZJHHS-UHFFFAOYSA-N
MW376.23 g/mol
LogP2.05
Rot. Bonds3

About 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid

3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid (PubChem CID 104517641) has the molecular formula C13H14BrNO5S and a molecular weight of 376.23 g/mol. Its IUPAC name is 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid.

Molecular Properties

Compound Name3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid
PubChem CID104517641
Molecular FormulaC13H14BrNO5S
Molecular Weight376.23 g/mol
Exact Mass374.98
IUPAC Name3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid
SMILESO=C(O)c1ccc(NC(=O)C2CCCCS2(=O)=O)c(Br)c1
InChIInChI=1S/C13H14BrNO5S/c14-9-7-8(13(17)18)4-5-10(9)15-12(16)11-3-1-2-6-21(11,19)20/h4-5,7,11H,1-3,6H2,(H,15,16)(H,17,18)
InChIKeyDVMZBPYHQZJHHS-UHFFFAOYSA-N
XLogP2.05
TPSA100.54 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500376.23
LogP ≤ 52.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid?
The IUPAC name of 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid (CID 104517641) is 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid.
What is the SMILES notation for 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid?
The canonical SMILES for 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid is O=C(O)c1ccc(NC(=O)C2CCCCS2(=O)=O)c(Br)c1.
What is the InChIKey of 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid?
The InChIKey is DVMZBPYHQZJHHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrNO5S/c14-9-7-8(13(17)18)4-5-10(9)15-12(16)11-3-1-2-6-21(11,19)20/h4-5,7,11H,1-3,6H2,(H,15,16)(H,17,18).
What are the key properties of 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid?
3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid has a molecular weight of 376.23 g/mol, XLogP of 2.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid is sourced from PubChem (CID 104517641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).