C13H14BrNO5S — CID 104517641
3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid (PubChem CID 104517641) has the molecular formula C13H14BrNO5S and a molecular weight of 376.23 g/mol. Its IUPAC name is 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid.
| Compound Name | 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 104517641 |
| Molecular Formula | C13H14BrNO5S |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 3-bromo-4-[(1,1-dioxothiane-2-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C2CCCCS2(=O)=O)c(Br)c1 |
| InChI | InChI=1S/C13H14BrNO5S/c14-9-7-8(13(17)18)4-5-10(9)15-12(16)11-3-1-2-6-21(11,19)20/h4-5,7,11H,1-3,6H2,(H,15,16)(H,17,18) |
| InChIKey | DVMZBPYHQZJHHS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |