C13H14N2O3S — CID 104519233
N-(2-cyanophenyl)-1,1-dioxothiane-2-carboxamide (PubChem CID 104519233) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is N-(2-cyanophenyl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(2-cyanophenyl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104519233 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-(2-cyanophenyl)-1,1-dioxothiane-2-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H14N2O3S/c14-9-10-5-1-2-6-11(10)15-13(16)12-7-3-4-8-19(12,17)18/h1-2,5-6,12H,3-4,7-8H2,(H,15,16) |
| InChIKey | NZDJNSRJQHIXLL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |