C12H16N2O3S — CID 113421791
N-(4-aminophenyl)-1,1-dioxothiane-2-carboxamide (PubChem CID 113421791) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-(4-aminophenyl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(4-aminophenyl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 113421791 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-(4-aminophenyl)-1,1-dioxothiane-2-carboxamide |
| SMILES | Nc1ccc(NC(=O)C2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C12H16N2O3S/c13-9-4-6-10(7-5-9)14-12(15)11-3-1-2-8-18(11,16)17/h4-7,11H,1-3,8,13H2,(H,14,15) |
| InChIKey | DGUCSJNZXBFXIE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|