C14H20N2O3S — CID 104517341
N-(4-aminophenyl)-N-ethyl-1,1-dioxothiane-2-carboxamide (PubChem CID 104517341) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(4-aminophenyl)-N-ethyl-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(4-aminophenyl)-N-ethyl-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104517341 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(4-aminophenyl)-N-ethyl-1,1-dioxothiane-2-carboxamide |
| SMILES | CCN(C(=O)C1CCCCS1(=O)=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H20N2O3S/c1-2-16(12-8-6-11(15)7-9-12)14(17)13-5-3-4-10-20(13,18)19/h6-9,13H,2-5,10,15H2,1H3 |
| InChIKey | UVPWFFASZGAHMY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|