C9H13N3O3S — CID 104520567
1,1-dioxo-N-(1H-pyrazol-4-yl)thiane-2-carboxamide (PubChem CID 104520567) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 1,1-dioxo-N-(1H-pyrazol-4-yl)thiane-2-carboxamide.
| Compound Name | 1,1-dioxo-N-(1H-pyrazol-4-yl)thiane-2-carboxamide |
|---|---|
| PubChem CID | 104520567 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1,1-dioxo-N-(1H-pyrazol-4-yl)thiane-2-carboxamide |
| SMILES | O=C(Nc1cn[nH]c1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C9H13N3O3S/c13-9(12-7-5-10-11-6-7)8-3-1-2-4-16(8,14)15/h5-6,8H,1-4H2,(H,10,11)(H,12,13) |
| InChIKey | ZGWDRQIUSUBGMV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |