C12H14ClNO4S — CID 104520082
N-(3-chloro-4-hydroxyphenyl)-1,1-dioxothiane-2-carboxamide (PubChem CID 104520082) has the molecular formula C12H14ClNO4S and a molecular weight of 303.77 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104520082 |
| Molecular Formula | C12H14ClNO4S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)-1,1-dioxothiane-2-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(Cl)c1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H14ClNO4S/c13-9-7-8(4-5-10(9)15)14-12(16)11-3-1-2-6-19(11,17)18/h4-5,7,11,15H,1-3,6H2,(H,14,16) |
| InChIKey | WRGSJYRVOPOUDS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|