C14H19ClN2O2 — CID 107679848
2-(aminomethyl)-N-(3-chloro-4-hydroxyphenyl)cyclohexane-1-carboxamide (PubChem CID 107679848) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3-chloro-4-hydroxyphenyl)cyclohexane-1-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(3-chloro-4-hydroxyphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107679848 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-(aminomethyl)-N-(3-chloro-4-hydroxyphenyl)cyclohexane-1-carboxamide |
| SMILES | NCC1CCCCC1C(=O)Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O2/c15-12-7-10(5-6-13(12)18)17-14(19)11-4-2-1-3-9(11)8-16/h5-7,9,11,18H,1-4,8,16H2,(H,17,19) |
| InChIKey | QHLWXVXNYHLWHW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|