C15H20F2N2O — CID 43549850
N-(5-amino-2,4-difluorophenyl)-3-cyclohexylpropanamide (PubChem CID 43549850) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is N-(5-amino-2,4-difluorophenyl)-3-cyclohexylpropanamide.
| Compound Name | N-(5-amino-2,4-difluorophenyl)-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 43549850 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-(5-amino-2,4-difluorophenyl)-3-cyclohexylpropanamide |
| SMILES | Nc1cc(NC(=O)CCC2CCCCC2)c(F)cc1F |
| InChI | InChI=1S/C15H20F2N2O/c16-11-8-12(17)14(9-13(11)18)19-15(20)7-6-10-4-2-1-3-5-10/h8-10H,1-7,18H2,(H,19,20) |
| InChIKey | AUAUJAOOXYDZLU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|