C24H29F3N2O — CID 154663570
N-[2-amino-4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]-3-cyclohexylpropanamide (PubChem CID 154663570) has the molecular formula C24H29F3N2O and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[2-amino-4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]-3-cyclohexylpropanamide.
| Compound Name | N-[2-amino-4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 154663570 |
| Molecular Formula | C24H29F3N2O |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-[2-amino-4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]-3-cyclohexylpropanamide |
| SMILES | Nc1cc(CCc2ccc(C(F)(F)F)cc2)ccc1NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C24H29F3N2O/c25-24(26,27)20-12-8-18(9-13-20)6-7-19-10-14-22(21(28)16-19)29-23(30)15-11-17-4-2-1-3-5-17/h8-10,12-14,16-17H,1-7,11,15,28H2,(H,29,30) |
| InChIKey | XTBKZGYVZRVCKN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|