C14H17BrF2N2O — CID 102853722
N-(5-bromo-2,4-difluorophenyl)-3-piperidin-4-ylpropanamide (PubChem CID 102853722) has the molecular formula C14H17BrF2N2O and a molecular weight of 347.20 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-3-piperidin-4-ylpropanamide.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-3-piperidin-4-ylpropanamide |
|---|---|
| PubChem CID | 102853722 |
| Molecular Formula | C14H17BrF2N2O |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-3-piperidin-4-ylpropanamide |
| SMILES | O=C(CCC1CCNCC1)Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C14H17BrF2N2O/c15-10-7-13(12(17)8-11(10)16)19-14(20)2-1-9-3-5-18-6-4-9/h7-9,18H,1-6H2,(H,19,20) |
| InChIKey | LTYFFTDUWNEGMY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|