C12H13BrF2N2O — CID 102853687
N-(5-bromo-2,4-difluorophenyl)-2-pyrrolidin-2-ylacetamide (PubChem CID 102853687) has the molecular formula C12H13BrF2N2O and a molecular weight of 319.15 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 102853687 |
| Molecular Formula | C12H13BrF2N2O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-2-pyrrolidin-2-ylacetamide |
| SMILES | O=C(CC1CCCN1)Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C12H13BrF2N2O/c13-8-5-11(10(15)6-9(8)14)17-12(18)4-7-2-1-3-16-7/h5-7,16H,1-4H2,(H,17,18) |
| InChIKey | GFUHOTOOYMKSGA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|