C12H13BrF2N2O2 — CID 102853805
N-(5-bromo-2,4-difluorophenyl)-2-morpholin-3-ylacetamide (PubChem CID 102853805) has the molecular formula C12H13BrF2N2O2 and a molecular weight of 335.15 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-2-morpholin-3-ylacetamide.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-2-morpholin-3-ylacetamide |
|---|---|
| PubChem CID | 102853805 |
| Molecular Formula | C12H13BrF2N2O2 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-2-morpholin-3-ylacetamide |
| SMILES | O=C(CC1COCCN1)Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C12H13BrF2N2O2/c13-8-4-11(10(15)5-9(8)14)17-12(18)3-7-6-19-2-1-16-7/h4-5,7,16H,1-3,6H2,(H,17,18) |
| InChIKey | JVPWBOGMMMAFDR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|