C15H20N2O4 — CID 106911781
N-[4-(1,3-dioxolan-2-yl)phenyl]-2-morpholin-3-ylacetamide (PubChem CID 106911781) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is N-[4-(1,3-dioxolan-2-yl)phenyl]-2-morpholin-3-ylacetamide.
| Compound Name | N-[4-(1,3-dioxolan-2-yl)phenyl]-2-morpholin-3-ylacetamide |
|---|---|
| PubChem CID | 106911781 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-[4-(1,3-dioxolan-2-yl)phenyl]-2-morpholin-3-ylacetamide |
| SMILES | O=C(CC1COCCN1)Nc1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C15H20N2O4/c18-14(9-13-10-19-6-5-16-13)17-12-3-1-11(2-4-12)15-20-7-8-21-15/h1-4,13,15-16H,5-10H2,(H,17,18) |
| InChIKey | RBPOGBVSTTUSGN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |