C17H20N2O3S — CID 95712846
N-[4-(furan-2-ylmethylsulfanyl)phenyl]-2-[(3R)-morpholin-3-yl]acetamide (PubChem CID 95712846) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylsulfanyl)phenyl]-2-[(3R)-morpholin-3-yl]acetamide.
| Compound Name | N-[4-(furan-2-ylmethylsulfanyl)phenyl]-2-[(3R)-morpholin-3-yl]acetamide |
|---|---|
| PubChem CID | 95712846 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[4-(furan-2-ylmethylsulfanyl)phenyl]-2-[(3R)-morpholin-3-yl]acetamide |
| SMILES | O=C(C[C@@H]1COCCN1)Nc1ccc(SCc2ccco2)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c20-17(10-14-11-21-9-7-18-14)19-13-3-5-16(6-4-13)23-12-15-2-1-8-22-15/h1-6,8,14,18H,7,9-12H2,(H,19,20)/t14-/m1/s1 |
| InChIKey | ASZBLMWMLGJAGS-CQSZACIVSA-N |
| XLogP | 2.89 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |