C20H24N2O3S — CID 97438150
1-[4-(furan-2-ylmethylsulfanyl)phenyl]-3-[(3S)-1-oxaspiro[4.4]nonan-3-yl]urea (PubChem CID 97438150) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-[4-(furan-2-ylmethylsulfanyl)phenyl]-3-[(3S)-1-oxaspiro[4.4]nonan-3-yl]urea.
| Compound Name | 1-[4-(furan-2-ylmethylsulfanyl)phenyl]-3-[(3S)-1-oxaspiro[4.4]nonan-3-yl]urea |
|---|---|
| PubChem CID | 97438150 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-[4-(furan-2-ylmethylsulfanyl)phenyl]-3-[(3S)-1-oxaspiro[4.4]nonan-3-yl]urea |
| SMILES | O=C(Nc1ccc(SCc2ccco2)cc1)N[C@@H]1COC2(CCCC2)C1 |
| InChI | InChI=1S/C20H24N2O3S/c23-19(22-16-12-20(25-13-16)9-1-2-10-20)21-15-5-7-18(8-6-15)26-14-17-4-3-11-24-17/h3-8,11,16H,1-2,9-10,12-14H2,(H2,21,22,23)/t16-/m0/s1 |
| InChIKey | GPCNIIYXWAWPGX-INIZCTEOSA-N |
| XLogP | 4.80 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |