C20H26N4O2 — CID 97437962
1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-[(3R)-1-oxaspiro[4.4]nonan-3-yl]urea (PubChem CID 97437962) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-[(3R)-1-oxaspiro[4.4]nonan-3-yl]urea.
| Compound Name | 1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-[(3R)-1-oxaspiro[4.4]nonan-3-yl]urea |
|---|---|
| PubChem CID | 97437962 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-[(3R)-1-oxaspiro[4.4]nonan-3-yl]urea |
| SMILES | Cc1cc(C)n(-c2ccc(NC(=O)N[C@H]3COC4(CCCC4)C3)cc2)n1 |
| InChI | InChI=1S/C20H26N4O2/c1-14-11-15(2)24(23-14)18-7-5-16(6-8-18)21-19(25)22-17-12-20(26-13-17)9-3-4-10-20/h5-8,11,17H,3-4,9-10,12-13H2,1-2H3,(H2,21,22,25)/t17-/m1/s1 |
| InChIKey | RKSXSZXJZQXQOX-QGZVFWFLSA-N |
| XLogP | 3.71 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |