C18H21N3O2S — CID 97437563
1-[(3S)-1-oxaspiro[4.4]nonan-3-yl]-3-[3-(1,3-thiazol-4-yl)phenyl]urea (PubChem CID 97437563) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-[(3S)-1-oxaspiro[4.4]nonan-3-yl]-3-[3-(1,3-thiazol-4-yl)phenyl]urea.
| Compound Name | 1-[(3S)-1-oxaspiro[4.4]nonan-3-yl]-3-[3-(1,3-thiazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 97437563 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-[(3S)-1-oxaspiro[4.4]nonan-3-yl]-3-[3-(1,3-thiazol-4-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2cscn2)c1)N[C@@H]1COC2(CCCC2)C1 |
| InChI | InChI=1S/C18H21N3O2S/c22-17(21-15-9-18(23-10-15)6-1-2-7-18)20-14-5-3-4-13(8-14)16-11-24-12-19-16/h3-5,8,11-12,15H,1-2,6-7,9-10H2,(H2,20,21,22)/t15-/m0/s1 |
| InChIKey | VCFLGMFRDIMMFX-HNNXBMFYSA-N |
| XLogP | 4.03 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |