C16H12ClN3OS — CID 135376255
1-(4-chlorophenyl)-3-[3-(1,3-thiazol-4-yl)phenyl]urea (PubChem CID 135376255) has the molecular formula C16H12ClN3OS and a molecular weight of 329.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-(1,3-thiazol-4-yl)phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-(1,3-thiazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 135376255 |
| Molecular Formula | C16H12ClN3OS |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-(1,3-thiazol-4-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cccc(-c2cscn2)c1 |
| InChI | InChI=1S/C16H12ClN3OS/c17-12-4-6-13(7-5-12)19-16(21)20-14-3-1-2-11(8-14)15-9-22-10-18-15/h1-10H,(H2,19,20,21) |
| InChIKey | RQPWMOJUTHPFSM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |