C24H27ClN4O — CID 118716100
1-(4-chlorophenyl)-3-[3-[6-(dipropylamino)-2-pyridinyl]phenyl]urea (PubChem CID 118716100) has the molecular formula C24H27ClN4O and a molecular weight of 422.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-[6-(dipropylamino)-2-pyridinyl]phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-[6-(dipropylamino)-2-pyridinyl]phenyl]urea |
|---|---|
| PubChem CID | 118716100 |
| Molecular Formula | C24H27ClN4O |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-[6-(dipropylamino)-2-pyridinyl]phenyl]urea |
| SMILES | CCCN(CCC)c1cccc(-c2cccc(NC(=O)Nc3ccc(Cl)cc3)c2)n1 |
| InChI | InChI=1S/C24H27ClN4O/c1-3-15-29(16-4-2)23-10-6-9-22(28-23)18-7-5-8-21(17-18)27-24(30)26-20-13-11-19(25)12-14-20/h5-14,17H,3-4,15-16H2,1-2H3,(H2,26,27,30) |
| InChIKey | MVWUOFXAHWXDOG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |