C19H13Cl3N2O — CID 135376465
1-(4-chlorophenyl)-3-[3-(2,6-dichlorophenyl)phenyl]urea (PubChem CID 135376465) has the molecular formula C19H13Cl3N2O and a molecular weight of 391.69 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-(2,6-dichlorophenyl)phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-(2,6-dichlorophenyl)phenyl]urea |
|---|---|
| PubChem CID | 135376465 |
| Molecular Formula | C19H13Cl3N2O |
| Molecular Weight | 391.69 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-(2,6-dichlorophenyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cccc(-c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C19H13Cl3N2O/c20-13-7-9-14(10-8-13)23-19(25)24-15-4-1-3-12(11-15)18-16(21)5-2-6-17(18)22/h1-11H,(H2,23,24,25) |
| InChIKey | RTFUWYINTKWQNH-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.69 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |