C23H23ClN3O+ — CID 140731858
1-(4-chlorophenyl)-3-[3-(1-cyclopentylpyridin-1-ium-4-yl)phenyl]urea (PubChem CID 140731858) has the molecular formula C23H23ClN3O+ and a molecular weight of 392.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-(1-cyclopentylpyridin-1-ium-4-yl)phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-(1-cyclopentylpyridin-1-ium-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 140731858 |
| Molecular Formula | C23H23ClN3O+ |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-(1-cyclopentylpyridin-1-ium-4-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cccc(-c2cc[n+](C3CCCC3)cc2)c1 |
| InChI | InChI=1S/C23H22ClN3O/c24-19-8-10-20(11-9-19)25-23(28)26-21-5-3-4-18(16-21)17-12-14-27(15-13-17)22-6-1-2-7-22/h3-5,8-16,22H,1-2,6-7H2,(H-,25,26,28)/p+1 |
| InChIKey | SGPHHHOBJPXSSY-UHFFFAOYSA-O |
| XLogP | 6.05 |
| TPSA | 45.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|