C16H19N3O2S — CID 72847558
1-(4-hydroxycyclohexyl)-3-[3-(1,3-thiazol-4-yl)phenyl]urea (PubChem CID 72847558) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(4-hydroxycyclohexyl)-3-[3-(1,3-thiazol-4-yl)phenyl]urea.
| Compound Name | 1-(4-hydroxycyclohexyl)-3-[3-(1,3-thiazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 72847558 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-(4-hydroxycyclohexyl)-3-[3-(1,3-thiazol-4-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2cscn2)c1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C16H19N3O2S/c20-14-6-4-12(5-7-14)18-16(21)19-13-3-1-2-11(8-13)15-9-22-10-17-15/h1-3,8-10,12,14,20H,4-7H2,(H2,18,19,21) |
| InChIKey | CXTJUCWSXQHXAM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |