C16H19N3O2S — CID 111578713
1-(4-hydroxycyclohexyl)-3-(3-phenyl-1,2-thiazol-5-yl)urea (PubChem CID 111578713) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(4-hydroxycyclohexyl)-3-(3-phenyl-1,2-thiazol-5-yl)urea.
| Compound Name | 1-(4-hydroxycyclohexyl)-3-(3-phenyl-1,2-thiazol-5-yl)urea |
|---|---|
| PubChem CID | 111578713 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-(4-hydroxycyclohexyl)-3-(3-phenyl-1,2-thiazol-5-yl)urea |
| SMILES | O=C(Nc1cc(-c2ccccc2)ns1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C16H19N3O2S/c20-13-8-6-12(7-9-13)17-16(21)18-15-10-14(19-22-15)11-4-2-1-3-5-11/h1-5,10,12-13,20H,6-9H2,(H2,17,18,21) |
| InChIKey | JJGDLNRROXBIHC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |