C13H14N4O2S — CID 71864926
N-methyl-2-[(3-phenyl-1,2-thiazol-5-yl)carbamoylamino]acetamide (PubChem CID 71864926) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is N-methyl-2-[(3-phenyl-1,2-thiazol-5-yl)carbamoylamino]acetamide.
| Compound Name | N-methyl-2-[(3-phenyl-1,2-thiazol-5-yl)carbamoylamino]acetamide |
|---|---|
| PubChem CID | 71864926 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-methyl-2-[(3-phenyl-1,2-thiazol-5-yl)carbamoylamino]acetamide |
| SMILES | CNC(=O)CNC(=O)Nc1cc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C13H14N4O2S/c1-14-11(18)8-15-13(19)16-12-7-10(17-20-12)9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,14,18)(H2,15,16,19) |
| InChIKey | MXNPNOVNDUNTQE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |