C14H15BrN2OS — CID 134087108
N-[3-(4-bromophenyl)-1,2-thiazol-5-yl]-3-methylbutanamide (PubChem CID 134087108) has the molecular formula C14H15BrN2OS and a molecular weight of 339.26 g/mol. Its IUPAC name is N-[3-(4-bromophenyl)-1,2-thiazol-5-yl]-3-methylbutanamide.
| Compound Name | N-[3-(4-bromophenyl)-1,2-thiazol-5-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 134087108 |
| Molecular Formula | C14H15BrN2OS |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | N-[3-(4-bromophenyl)-1,2-thiazol-5-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1cc(-c2ccc(Br)cc2)ns1 |
| InChI | InChI=1S/C14H15BrN2OS/c1-9(2)7-13(18)16-14-8-12(17-19-14)10-3-5-11(15)6-4-10/h3-6,8-9H,7H2,1-2H3,(H,16,18) |
| InChIKey | BYBPEJDPGXVAAT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |