C11H14BrNO3S — CID 47108774
N-(4-bromophenyl)sulfonyl-3-methylbutanamide (PubChem CID 47108774) has the molecular formula C11H14BrNO3S and a molecular weight of 320.21 g/mol. Its IUPAC name is N-(4-bromophenyl)sulfonyl-3-methylbutanamide.
| Compound Name | N-(4-bromophenyl)sulfonyl-3-methylbutanamide |
|---|---|
| PubChem CID | 47108774 |
| Molecular Formula | C11H14BrNO3S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | N-(4-bromophenyl)sulfonyl-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H14BrNO3S/c1-8(2)7-11(14)13-17(15,16)10-5-3-9(12)4-6-10/h3-6,8H,7H2,1-2H3,(H,13,14) |
| InChIKey | YHMHTNHUCODKGY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |