C16H12N4O2S — CID 136529338
2-N-(3-phenyl-1,2-thiazol-5-yl)pyridine-2,5-dicarboxamide (PubChem CID 136529338) has the molecular formula C16H12N4O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-N-(3-phenyl-1,2-thiazol-5-yl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(3-phenyl-1,2-thiazol-5-yl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 136529338 |
| Molecular Formula | C16H12N4O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-N-(3-phenyl-1,2-thiazol-5-yl)pyridine-2,5-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)Nc2cc(-c3ccccc3)ns2)nc1 |
| InChI | InChI=1S/C16H12N4O2S/c17-15(21)11-6-7-12(18-9-11)16(22)19-14-8-13(20-23-14)10-4-2-1-3-5-10/h1-9H,(H2,17,21)(H,19,22) |
| InChIKey | BEYFZQDAXVHWEH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |