C17H14ClN3S2 — CID 56688708
3-[3-(4-chlorophenyl)-1,2-thiazol-5-yl]-1-methyl-1-phenylthiourea (PubChem CID 56688708) has the molecular formula C17H14ClN3S2 and a molecular weight of 359.91 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-1,2-thiazol-5-yl]-1-methyl-1-phenylthiourea.
| Compound Name | 3-[3-(4-chlorophenyl)-1,2-thiazol-5-yl]-1-methyl-1-phenylthiourea |
|---|---|
| PubChem CID | 56688708 |
| Molecular Formula | C17H14ClN3S2 |
| Molecular Weight | 359.91 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-1,2-thiazol-5-yl]-1-methyl-1-phenylthiourea |
| SMILES | CN(C(=S)Nc1cc(-c2ccc(Cl)cc2)ns1)c1ccccc1 |
| InChI | InChI=1S/C17H14ClN3S2/c1-21(14-5-3-2-4-6-14)17(22)19-16-11-15(20-23-16)12-7-9-13(18)10-8-12/h2-11H,1H3,(H,19,22) |
| InChIKey | FTNYVOZGRMZMFM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.91 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|