C13H15N3O2S — CID 70519026
3-[3-(3-methoxyphenyl)-1,2-thiazol-5-yl]-1,1-dimethylurea (PubChem CID 70519026) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 3-[3-(3-methoxyphenyl)-1,2-thiazol-5-yl]-1,1-dimethylurea.
| Compound Name | 3-[3-(3-methoxyphenyl)-1,2-thiazol-5-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 70519026 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-[3-(3-methoxyphenyl)-1,2-thiazol-5-yl]-1,1-dimethylurea |
| SMILES | COc1cccc(-c2cc(NC(=O)N(C)C)sn2)c1 |
| InChI | InChI=1S/C13H15N3O2S/c1-16(2)13(17)14-12-8-11(15-19-12)9-5-4-6-10(7-9)18-3/h4-8H,1-3H3,(H,14,17) |
| InChIKey | HEVMLSPZNXWHGJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |