C16H18N6O2 — CID 58243120
1-(dimethylamino)-3-[6-(3-methoxyphenyl)imidazo[1,2-b]pyridazin-2-yl]urea (PubChem CID 58243120) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[6-(3-methoxyphenyl)imidazo[1,2-b]pyridazin-2-yl]urea.
| Compound Name | 1-(dimethylamino)-3-[6-(3-methoxyphenyl)imidazo[1,2-b]pyridazin-2-yl]urea |
|---|---|
| PubChem CID | 58243120 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-(dimethylamino)-3-[6-(3-methoxyphenyl)imidazo[1,2-b]pyridazin-2-yl]urea |
| SMILES | COc1cccc(-c2ccc3nc(NC(=O)NN(C)C)cn3n2)c1 |
| InChI | InChI=1S/C16H18N6O2/c1-21(2)20-16(23)18-14-10-22-15(17-14)8-7-13(19-22)11-5-4-6-12(9-11)24-3/h4-10H,1-3H3,(H2,18,20,23) |
| InChIKey | GLTOEPRCUVZLOO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|