C20H17N5O — CID 58243302
1-methyl-3-[6-(4-phenylphenyl)imidazo[1,2-b]pyridazin-2-yl]urea (PubChem CID 58243302) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-methyl-3-[6-(4-phenylphenyl)imidazo[1,2-b]pyridazin-2-yl]urea.
| Compound Name | 1-methyl-3-[6-(4-phenylphenyl)imidazo[1,2-b]pyridazin-2-yl]urea |
|---|---|
| PubChem CID | 58243302 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-methyl-3-[6-(4-phenylphenyl)imidazo[1,2-b]pyridazin-2-yl]urea |
| SMILES | CNC(=O)Nc1cn2nc(-c3ccc(-c4ccccc4)cc3)ccc2n1 |
| InChI | InChI=1S/C20H17N5O/c1-21-20(26)23-18-13-25-19(22-18)12-11-17(24-25)16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-13H,1H3,(H2,21,23,26) |
| InChIKey | DRMQLUOYYURCPB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |