C14H14N4O — CID 143879206
6-(3-methoxyphenyl)-N-methylimidazo[1,2-b]pyridazin-2-amine (PubChem CID 143879206) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-N-methylimidazo[1,2-b]pyridazin-2-amine.
| Compound Name | 6-(3-methoxyphenyl)-N-methylimidazo[1,2-b]pyridazin-2-amine |
|---|---|
| PubChem CID | 143879206 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 6-(3-methoxyphenyl)-N-methylimidazo[1,2-b]pyridazin-2-amine |
| SMILES | CNc1cn2nc(-c3cccc(OC)c3)ccc2n1 |
| InChI | InChI=1S/C14H14N4O/c1-15-13-9-18-14(16-13)7-6-12(17-18)10-4-3-5-11(8-10)19-2/h3-9,15H,1-2H3 |
| InChIKey | BIZXPGLMSWBOAU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |